For research use only. Not for therapeutic Use.
2,4-Difluoro-3-isopropoxyphenylboronic acid(Cat No.:L026270)is an organoboron compound used in pharmaceutical and chemical research, particularly in the synthesis of complex organic molecules. This compound features a phenyl ring substituted with two fluorine atoms at the 2- and 4-positions, an isopropoxy group at the 3-position, and a boronic acid group. It is commonly employed in Suzuki-Miyaura cross-coupling reactions, which are essential for forming carbon-carbon bonds in the development of bioactive compounds. Its unique structure makes it a valuable intermediate in medicinal chemistry and materials science.
CAS Number | 1451390-95-6 |
Molecular Formula | C9H11BF2O3 |
Purity | ≥95% |
IUPAC Name | (2,4-difluoro-3-propan-2-yloxyphenyl)boronic acid |
InChI | InChI=1S/C9H11BF2O3/c1-5(2)15-9-7(11)4-3-6(8(9)12)10(13)14/h3-5,13-14H,1-2H3 |
InChIKey | LTXLJWCQTYVYCS-UHFFFAOYSA-N |
SMILES | B(C1=C(C(=C(C=C1)F)OC(C)C)F)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |