For research use only. Not for therapeutic Use.
2,4-Dichloro-6-hydroxybenzaldehyde(CAT: L023319) is a high-purity aromatic compound featuring dichloro substitutions and a hydroxy group on a benzaldehyde framework. This versatile molecule serves as a critical intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure makes it particularly valuable in the development of bioactive molecules, such as enzyme inhibitors and antimicrobial agents. With excellent chemical stability and reactivity, 2,4-Dichloro-6-hydroxybenzaldehyde supports innovative approaches in medicinal chemistry, material science, and industrial research, offering reliable performance across diverse chemical transformations.
CAS Number | 78443-72-8 |
Molecular Formula | C7H4Cl2O2 |
Purity | ≥95% |
IUPAC Name | 2,4-dichloro-6-hydroxybenzaldehyde |
InChI | InChI=1S/C7H4Cl2O2/c8-4-1-6(9)5(3-10)7(11)2-4/h1-3,11H |
InChIKey | XFYKHXQQNRESHU-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1O)C=O)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |