For research use only. Not for therapeutic Use.
2,4-Dichloro-5-(trifluoromethyl)quinazoline(Cat No.:L032794)is a highly reactive heterocyclic compound used in pharmaceutical research and organic synthesis. The quinazoline core, substituted with two chlorine atoms at the 2 and 4 positions and a trifluoromethyl group at the 5 position, provides significant reactivity and stability, making it an ideal building block for creating complex molecules. This compound is particularly valuable in the synthesis of kinase inhibitors and other biologically active agents. Its unique functional groups enable diverse chemical transformations, essential for drug discovery and advanced medicinal chemistry.
CAS Number | 134517-56-9 |
Molecular Formula | C9H3Cl2F3N2 |
Purity | ≥95% |
IUPAC Name | 2,4-dichloro-5-(trifluoromethyl)quinazoline |
InChI | InChI=1S/C9H3Cl2F3N2/c10-7-6-4(9(12,13)14)2-1-3-5(6)15-8(11)16-7/h1-3H |
InChIKey | MGMZEWORTYBDQY-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=C1)N=C(N=C2Cl)Cl)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |