For research use only. Not for therapeutic Use.
2,4-Dibromothiophene is a brominated heterocyclic compound with two bromine atoms attached to the 2- and 4-positions on a thiophene ring. This structure enhances the reactivity of the thiophene, making it a valuable intermediate in organic synthesis, particularly for cross-coupling reactions such as Suzuki or Stille coupling. Widely used in materials science, 2,4-dibromothiophene serves as a building block for constructing polymers and advanced materials with conductive or electronic properties, contributing to fields like organic electronics and photovoltaics.
| CAS Number | 3140-92-9 |
| Molecular Formula | C4H2Br2S |
| Purity | ≥95% |
| IUPAC Name | 2,4-dibromothiophene |
| InChI | InChI=1S/C4H2Br2S/c5-3-1-4(6)7-2-3/h1-2H |
| InChIKey | WAQFYSJKIRRXLP-UHFFFAOYSA-N |
| SMILES | C1=C(SC=C1Br)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
