For research use only. Not for therapeutic Use.
2,4-Dibromo-1,3,5-trifluorobenzene(Cat No.:L025941)is a halogenated aromatic compound featuring two bromine atoms and three fluorine atoms symmetrically substituted on a benzene ring. Its highly electron-deficient structure, due to the strong electron-withdrawing nature of fluorine and bromine, makes it useful in the synthesis of advanced materials and pharmaceuticals. The bromine atoms provide reactive sites for palladium-catalyzed cross-coupling reactions such as Suzuki or Sonogashira couplings, enabling the construction of complex aromatic systems. This compound is also employed in designing liquid crystals, agrochemicals, and fluorinated building blocks in organic and materials chemistry.
| CAS Number | 363-69-9 |
| Molecular Formula | C6HBr2F3 |
| Purity | ≥95% |
| IUPAC Name | 2,4-dibromo-1,3,5-trifluorobenzene |
| InChI | InChI=1S/C6HBr2F3/c7-4-2(9)1-3(10)5(8)6(4)11/h1H |
| InChIKey | SFNQFVCUPVBCOC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)F)Br)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |