For research use only. Not for therapeutic Use.
2,4-Diamino-6-piperidinopyrimidine(Cat No.:R003059), also known as Desoxyminoxidil, is a chemical compound with the molecular formula C9H19N5. It is a derivative of minoxidil, a medication used to treat hair loss and hypertension. Desoxyminoxidil lacks the oxygen atom present in minoxidil’s heterocyclic ring, resulting in altered pharmacological properties. It is considered a potential prodrug of minoxidil, which means it may convert to minoxidil in the body. Desoxyminoxidil’s modified structure contributes to its mechanism of action in promoting hair growth and potentially has implications in the development of improved treatments for hair loss conditions.
| CAS Number | 24867-26-3 |
| Synonyms | 6-(1-Piperidinyl)-2,4-pyrimidinediamine; 6-(1-Piperidinyl)-2,4-pyrimidinediamine; Desoxyminoxidil; |
| Molecular Formula | C9H15N5 |
| Purity | ≥95% |
| Storage | 2–8 °C |
| IUPAC Name | 6-piperidin-1-ylpyrimidine-2,4-diamine |
| InChI | InChI=1S/C9H15N5/c10-7-6-8(13-9(11)12-7)14-4-2-1-3-5-14/h6H,1-5H2,(H4,10,11,12,13) |
| InChIKey | IPFIEHIRBSTAKA-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=CC(=NC(=N2)N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |