For research use only. Not for therapeutic Use.
2(3H)-Furanone, 5-dodecyldihydro-(CAT: L000388) is a compound with potential applications in the field of organic chemistry. Its unique furanone structure makes it a valuable intermediate in the synthesis of various organic molecules. In organic chemistry, it can serve as a building block for creating compounds with specific functionalities or as an intermediate in the production of specialty chemicals.
CAS Number | 730-46-1 |
Molecular Formula | C16H30O2 |
Purity | ≥95% |
IUPAC Name | 5-dodecyloxolan-2-one |
InChI | InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-15-13-14-16(17)18-15/h15H,2-14H2,1H3 |
InChIKey | SRIFJCOBFTWCTM-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |