For research use only. Not for therapeutic Use.
2,3,5-Trimethylhexane(Cat No.:M067663) is a branched-chain alkane with the molecular formula C9H20. Its structure consists of a six-carbon chain with three methyl groups attached at the 2nd, 3rd, and 5th carbon positions. This arrangement results in a highly branched molecule with no stereocenters. 2,3,5-Trimethylhexane is a colorless liquid at room temperature and is insoluble in water. It is primarily used as a solvent in various industrial applications, such as in paints, coatings, and adhesives.
| CAS Number | 1069-53-0 |
| Molecular Formula | C9H20 |
| Purity | ≥95% |
| Storage | -20°C |
| Related CAS | 108-08-7 79-29-8 565-75-3 75-28-5 |
| IUPAC Name | 2,3,5-trimethylhexane |
| InChI | InChI=1S/C9H20/c1-7(2)6-9(5)8(3)4/h7-9H,6H2,1-5H3 |
| InChIKey | ODGLTLJZCVNPBU-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)C(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |