For research use only. Not for therapeutic Use.
2,2′,4,4′-Tetrahydroxybenzophenone (Cat No.: L046706) is a polyhydroxylated aromatic ketone featuring a benzophenone core with four hydroxyl groups. This yellow crystalline compound is known for its strong ultraviolet (UV) light absorption, making it valuable as a UV stabilizer in plastics, coatings, and cosmetics. It protects materials from photodegradation and discoloration. Additionally, its hydroxyl groups offer potential for further chemical modification, making it useful in polymer chemistry and dye manufacturing. The compound also finds applications in analytical and environmental chemistry as a UV-absorbing agent.
| CAS Number | 31127-54-5 |
| Molecular Formula | C13H10O5 |
| Purity | ≥95% |
| IUPAC Name | (4-hydroxyphenyl)-(2,3,4-trihydroxyphenyl)methanone |
| InChI | InChI=1S/C13H10O5/c14-8-3-1-7(2-4-8)11(16)9-5-6-10(15)13(18)12(9)17/h1-6,14-15,17-18H |
| InChIKey | ZRDYULMDEGRWRC-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
