For research use only. Not for therapeutic Use.
2,3-Dihydroisoquinoline-1,4-dione(CAT: L011826) is a high-purity heterocyclic compound featuring a unique isoquinoline core with two carbonyl functionalities. This versatile molecule is widely employed as a key intermediate in pharmaceutical and chemical research, particularly in the synthesis of bioactive compounds and heterocyclic frameworks. Its redox-active structure makes it valuable in the development of antioxidants, enzyme inhibitors, and other therapeutic candidates. With excellent stability and defined reactivity, 2,3-Dihydroisoquinoline-1,4-dione supports innovative advancements in medicinal chemistry, material science, and synthetic organic chemistry, serving as a critical building block for precision-driven chemical transformations.
| CAS Number | 31053-30-2 |
| Molecular Formula | C9H7NO2 |
| Purity | ≥95% |
| IUPAC Name | 2,3-dihydroisoquinoline-1,4-dione |
| InChI | InChI=1S/C9H7NO2/c11-8-5-10-9(12)7-4-2-1-3-6(7)8/h1-4H,5H2,(H,10,12) |
| InChIKey | WRRHHSIPJQOVJM-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC=CC=C2C(=O)N1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |