For research use only. Not for therapeutic Use.
2,3-Dicyanopyrazine(Cat No.:M053717)is a nitrogen-rich heterocyclic compound featuring two cyano groups at the 2 and 3 positions of a pyrazine ring. This electron-deficient structure makes it a valuable intermediate in organic synthesis, especially in the development of advanced materials, pharmaceuticals, and agrochemicals. Its strong electron-withdrawing nitrile groups enhance reactivity in nucleophilic and cross-coupling reactions. Additionally, 2,3-dicyanopyrazine is used in the design of ligands for coordination chemistry and in the synthesis of heterocyclic frameworks. Its aromatic stability and functional versatility make it a key building block in electronic and medicinal chemistry.
| CAS Number | 13481-25-9 |
| Molecular Formula | C6H2N4 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | pyrazine-2,3-dicarbonitrile |
| InChI | InChI=1S/C6H2N4/c7-3-5-6(4-8)10-2-1-9-5/h1-2H |
| InChIKey | OTVZGAXESBAAQQ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C#N)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |