For research use only. Not for therapeutic Use.
2,3-Dichloro-6-methoxypyridine(Cat No.:L038649)is a halogenated heterocyclic compound with significant applications in pharmaceutical and agrochemical research. Featuring a pyridine ring substituted with chlorine atoms at the 2- and 3-positions and a methoxy group at the 6-position, this compound serves as a crucial intermediate in synthesizing bioactive molecules, including herbicides, insecticides, and pharmaceutical agents. Its unique structure allows for selective chemical reactions, making it valuable in the development of complex organic compounds. Additionally, it is used in studies involving reaction mechanisms and synthetic methodologies.
CAS Number | 83732-68-7 |
Molecular Formula | C6H5Cl2NO |
Purity | ≥95% |
IUPAC Name | 2,3-dichloro-6-methoxypyridine |
InChI | InChI=1S/C6H5Cl2NO/c1-10-5-3-2-4(7)6(8)9-5/h2-3H,1H3 |
InChIKey | PCVPVMZNHMYIDP-UHFFFAOYSA-N |
SMILES | COC1=NC(=C(C=C1)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |