For research use only. Not for therapeutic Use.
2,3-Dichloro-6-hydroxypyridine is an aromatic compound with a pyridine ring, featuring chlorine atoms at the 2- and 3-positions, and a hydroxyl group (-OH) at the 6-position. The dichloro substitution imparts electron-withdrawing properties, while the hydroxyl group increases polarity and solubility. This compound is often used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and other bioactive molecules. It may have potential applications in medicinal chemistry, including antimicrobial or anticancer research, due to its functional groups.
CAS Number | 24525-63-1 |
Molecular Formula | C5H3Cl2NO |
Purity | ≥95% |
IUPAC Name | 5,6-dichloro-1H-pyridin-2-one |
InChI | InChI=1S/C5H3Cl2NO/c6-3-1-2-4(9)8-5(3)7/h1-2H,(H,8,9) |
InChIKey | BIZWANSOFTWATG-UHFFFAOYSA-N |
SMILES | C1=CC(=O)NC(=C1Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |