For research use only. Not for therapeutic Use.
2,3-Dehydrokievitone（Cat No.:R030681）is a naturally occurring isoflavonoid derivative found in leguminous plants such as Glycine max (soybean) and Lupinus species. It is structurally related to kievitone but contains a double bond between the 2 and 3 carbon atoms, which enhances its biological activity. This compound exhibits antimicrobial, antifungal, and phytoalexin properties, playing a defensive role in plant immunity. Additionally, 2,3-dehydrokievitone shows potential anticancer and antioxidant effects by modulating oxidative stress and cell signaling pathways. Its bioactivity makes it a valuable candidate for agricultural and pharmaceutical research targeting infection and inflammation.
| CAS Number | 74161-25-4 |
| Synonyms | 3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one |
| Molecular Formula | C20H18O6 |
| Purity | ≥95% |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-8-(3-methylbut-2-enyl)chromen-4-one |
| InChI | InChI=1S/C20H18O6/c1-10(2)3-5-13-16(23)8-17(24)18-19(25)14(9-26-20(13)18)12-6-4-11(21)7-15(12)22/h3-4,6-9,21-24H,5H2,1-2H3 |
| InChIKey | RWDSADRZXTYPMY-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C(=CO2)C3=C(C=C(C=C3)O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
