For research use only. Not for therapeutic Use.
2’3′-cGAMP (Cyclic GMP-AMP)(CAT: R066668) is a naturally occurring cyclic dinucleotide that plays a crucial role in the immune system as a second messenger. It is produced by the enzyme cGAS (cyclic GMP-AMP synthase) in response to the detection of cytosolic DNA, which often indicates the presence of viral or bacterial infections. 2’3′-cGAMP binds to the STING (Stimulator of Interferon Genes) receptor, triggering a signaling cascade that leads to the production of type I interferons and other cytokines, which are essential for the immune response. This molecule is of significant interest in immunology research, particularly in the study of innate immunity, cancer immunotherapy, and the development of novel vaccines. Its role in the activation of the immune system makes it a promising target for therapeutic intervention in various diseases.
CAS Number | 1441190-66-4 |
Synonyms | 2’3′-cGAMP; Guanosine-Adenosine 2′,3′-cyclic monophosphate;2′-3′-Cyclic GMP-AMP |
Molecular Formula | C20H24N10O13P2 |
Purity | ≥95% |
Target | Immunology/Inflammation |
Storage | -20°C |
IUPAC Name | 2-amino-9-[(1R,6R,8R,9R,10S,15R,17R,18R)-8-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3lambda5,12lambda5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
InChI | InChI=1S/C20H24N10O13P2/c21-14-8-15(24-3-23-14)29(4-25-8)18-11(32)12-7(41-18)2-39-45(36,37)43-13-10(31)6(1-38-44(34,35)42-12)40-19(13)30-5-26-9-16(30)27-20(22)28-17(9)33/h3-7,10-13,18-19,31-32H,1-2H2,(H,34,35)(H,36,37)(H2,21,23,24)(H3,22,27,28,33)/t6 |
InChIKey | XRILCFTWUCUKJR-INFSMZHSSA-N |
SMILES | O=P1(O)O[C@]([C@@H](O)[C@H](N2C=NC3=C2N=CN=C3N)O4)([H])[C@@]4([H])COP(O[C@@]5([H])[C@H](N6C=NC7=C6NC(N)=NC7=O)O[C@]([C@H]5O)([H])CO1)(O)=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |