For research use only. Not for therapeutic Use.
2,2,6,6-Tetramethyl-3,5-heptanedione (Cat No.: M047821), also known as dipivaloylmethane (DPM), is a β-diketone featuring bulky tetramethyl-substituted alkyl groups. It is widely used as a chelating ligand in coordination chemistry and metal-organic synthesis, particularly for forming stable metal complexes with transition metals, lanthanides, and actinides. Its steric bulk provides enhanced volatility and thermal stability, making it useful in metal deposition processes like chemical vapor deposition (CVD). Additionally, DPM-metal complexes serve roles in catalysis, materials science, and analytical applications.
CAS Number | 1118-71-4 |
Molecular Formula | C11H20O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,2,6,6-tetramethylheptane-3,5-dione |
InChI | InChI=1S/C11H20O2/c1-10(2,3)8(12)7-9(13)11(4,5)6/h7H2,1-6H3 |
InChIKey | YRAJNWYBUCUFBD-UHFFFAOYSA-N |
SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |