2,2,4,6,6-PENTAMETHYL-3-HEPTENE - CAS 123-48-8

2,2,4,6,6-Pentamethyl-3-heptene (Cat.No:M067284) is a branched, highly stable hydrocarbon with five methyl groups attached to a heptene backbone. This compound finds use in the synthesis of specialty chemicals, including fragrances and polymers. Its unique structure imparts specific properties that make it valuable in various industrial applications.

Catalog Number: M067284

CAS Number: 123-48-8

PubChem Substance ID:355080578

Molecular Formula: C12H24

Molecular Weight:168.324

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

Synonyms3-Heptene, 2,2,4,6,6-pentamethyl-;(E)-2,2,4,6,6-pentamethylhept-3-ene

Property

Molecular Formula: C12H24
Molecular Weight168.324
Purity≥95%
StorageStore at RT

Computed Descriptor

IUPAC Name(E)-2,2,4,6,6-pentamethylhept-3-ene
InChIInChI=1S/C12H24/c1-10(8-11(2,3)4)9-12(5,6)7/h8H,9H2,1-7H3/b10-8+
InChIKeyNBUMCEJRJRRLCA-CSKARUKUSA-N
SMILESCC(=CC(C)(C)C)CC(C)(C)C