2,2’,3,3’,4,4’,5,5’,6-Nonabromobiphenyl (Cat.No:R045555) is a chemical compound belonging to the class of brominated flame retardants. It is used to reduce the flammability of various materials, including plastics and textiles.
Catalog Number | R045555 |
CAS Number | 69278-62-2 |
Synonyms | 2,2’,3,3’,4,4’,5,5’,6-Nonobromobiphenyl; PBB 206 |
Molecular Formula | C12HBr9 |
Purity | 0% |
Storage | Store at RT |
IUPAC Name | 1,2,3,4,5-pentabromo-6-(2,3,4,5-tetrabromophenyl)benzene |
InChI | InChI=1S/C12HBr9/c13-3-1-2(5(14)9(18)6(3)15)4-7(16)10(19)12(21)11(20)8(4)17/h1H |
InChIKey | QLERKXRXNDBTDM-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(C(=C1Br)Br)Br)Br)C2=C(C(=C(C(=C2Br)Br)Br)Br)Br |