For research use only. Not for therapeutic Use.
2,2,2-Trichloro-1-phenylethyl acetate is an acetate ester featuring a trichloromethyl group and a phenyl ring, making it valuable in organic synthesis and pharmaceutical research. The trichloromethyl group contributes to the compound’s reactivity, allowing it to serve as an intermediate in the production of more complex molecules, particularly in drug development and agrochemical synthesis. Known for its stability and unique structure, 2,2,2-Trichloro-1-phenylethyl acetate is often utilized to introduce specific functional groups in advanced chemical applications.
| CAS Number | 90-17-5 |
| Molecular Formula | C10H9Cl3O2 |
| Purity | ≥95% |
| IUPAC Name | (2,2,2-trichloro-1-phenylethyl) acetate |
| InChI | InChI=1S/C10H9Cl3O2/c1-7(14)15-9(10(11,12)13)8-5-3-2-4-6-8/h2-6,9H,1H3 |
| InChIKey | JKRWZLOCPLZZEI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(C1=CC=CC=C1)C(Cl)(Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |