2,2′-Dithiobis(pyridine-N-oxide) (Cat.No:R070503) is a chemical compound used as a ligand in coordination chemistry. It possesses two pyridine-N-oxide functional groups connected by a sulfur atom. This versatile compound forms stable complexes with various metal ions, making it valuable in catalysis, coordination chemistry, and other research applications involving metal-ligand interactions.
Catalog Number | R070503 |
CAS Number | 3696-28-4 |
Synonyms | Olin |
Molecular Formula | C10H8N2O2S2 |
Purity | 95% |
Storage | Store at RT |
IUPAC Name | 1-oxido-2-[(1-oxidopyridin-1-ium-2-yl)disulfanyl]pyridin-1-ium |
InChI | InChI=1S/C10H8N2O2S2/c13-11-7-3-1-5-9(11)15-16-10-6-2-4-8-12(10)14/h1-8H |
InChIKey | ZHDBTKPXEJDTTQ-UHFFFAOYSA-N |
SMILES | C1=CC=[N+](C(=C1)SSC2=CC=CC=[N+]2[O-])[O-] |