For research use only. Not for therapeutic Use.
2,2-Diphenylglycine(Cat No.:R060683)is a non-proteinogenic α-amino acid with the molecular formula C14H13NO2. It features a glycine backbone substituted at the α-carbon with two phenyl groups, making it a bulky and rigid molecule. This structural configuration imparts unique steric and electronic properties, making it valuable in asymmetric synthesis, peptide design, and medicinal chemistry. It serves as a chiral auxiliary or building block in the development of pharmaceuticals and enzyme inhibitors. The compound’s aromatic groups also enhance hydrophobic interactions, influencing binding affinity and conformational stability in bioactive peptides and molecular recognition systems.
| CAS Number | 3060-50-2 |
| Synonyms | α-Amino-α-phenylbenzeneacetic Acid; 2,2-Diphenyl Glycine; 2-Amino-2,2-diphenylacetic Acid; Amino(diphenyl)acetic Acid; NSC 33392; α,α-Diphenylglycine; α-Aminodiphenylacetic Acid; USP Phenytoin Related Compound A; |
| Molecular Formula | C14H13NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-amino-2,2-diphenylacetic acid |
| InChI | InChI=1S/C14H13NO2/c15-14(13(16)17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,15H2,(H,16,17) |
| InChIKey | YBONNYNNFBAKLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |