For research use only. Not for therapeutic Use.
2,2-Dimethyl-1,3-dioxan-5-one (Cat.No:R020860) is a cyclic ester used in the synthesis of biodegradable polymers. Its unique structure lends stability and versatility, making it valuable in drug delivery systems and biomedical applications. This compound has garnered interest for its potential in controlled release formulations and tissue engineering.
CAS Number | 74181-34-3 |
Molecular Formula | C6H10O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,2-dimethyl-1,3-dioxan-5-one |
InChI | InChI=1S/C6H10O3/c1-6(2)8-3-5(7)4-9-6/h3-4H2,1-2H3 |
InChIKey | ASFQDNDZFGFMMP-UHFFFAOYSA-N |
SMILES | CC1(OCC(=O)CO1)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |