2,2-Difluoroethenyl 4-methylbenzene-1-sulfonate(Cat No.:L007785), is a chemical compound. It is a member of the sulfonic acid ester class and contains a sulfonate group (SO₃) attached to a benzene ring, with a difluoroethenyl group (C₂HF₂) and a methyl group (CH₃) substituting other positions on the benzene ring. Compounds of this type are often utilized as reagents or intermediates in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. They play a vital role in the creation of complex molecules by serving as building blocks in various chemical reactions.
Catalog Number | L007785 |
CAS Number | 185739-14-4 |
Molecular Formula | C9H8F2O3S |
Purity | 95% |
IUPAC Name | 2,2-difluoroethenyl 4-methylbenzenesulfonate |
InChI | InChI=1S/C9H8F2O3S/c1-7-2-4-8(5-3-7)15(12,13)14-6-9(10)11/h2-6H,1H3 |
InChIKey | ZQLLPWMNXQYESO-UHFFFAOYSA-N |
SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC=C(F)F |