For research use only. Not for therapeutic Use.
2,2-Bis(4-carboxyphenyl)hexafluoropropane (Cat No.: M051051) is a fluorinated aromatic compound featuring two carboxylic acid-substituted phenyl rings attached to a central hexafluoropropane core. This compound is commonly used as a monomer or building block in the synthesis of high-performance polymers such as polyesters and polyimides. Its structure imparts exceptional thermal stability, chemical resistance, and hydrophobicity, making it suitable for advanced materials in electronics, membranes, and aerospace applications. The presence of carboxylic acid groups allows for further functionalization and polymer cross-linking, enhancing material versatility and durability.
| CAS Number | 1171-47-7 |
| Molecular Formula | C17H10F6O4 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 4-[2-(4-carboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid |
| InChI | InChI=1S/C17H10F6O4/c18-16(19,20)15(17(21,22)23,11-5-1-9(2-6-11)13(24)25)12-7-3-10(4-8-12)14(26)27/h1-8H,(H,24,25)(H,26,27) |
| InChIKey | PHQYMDAUTAXXFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)C(C2=CC=C(C=C2)C(=O)O)(C(F)(F)F)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
