For research use only. Not for therapeutic Use.
2,2′-Bipyrimidine（Cat No.:L017883）is a nitrogen-rich heteroaromatic compound composed of two pyrimidine rings connected at their 2-positions. This symmetrical, planar molecule serves as a versatile bidentate ligand in coordination chemistry, capable of chelating metal centers through its two nitrogen atoms. It is widely used in the development of metal complexes for catalysis, electronic materials, and photophysical applications. The bipyrimidine structure also offers potential in medicinal chemistry, where its electron-deficient nature and ability to form hydrogen bonds support interactions with biological targets. Its rigidity and tunable properties make it valuable in supramolecular and materials science.
| CAS Number | 34671-83-5 |
| Molecular Formula | C8H6N4 |
| Purity | ≥95% |
| IUPAC Name | 2-pyrimidin-2-ylpyrimidine |
| InChI | InChI=1S/C8H6N4/c1-3-9-7(10-4-1)8-11-5-2-6-12-8/h1-6H |
| InChIKey | HKOAFLAGUQUJQG-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=NC=CC=N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
