For research use only. Not for therapeutic Use.
2,2′-Azobis(N-butyl-2-methylpropionamide)(Cat No.:M033657) is a chemical compound primarily used as a radical initiator in various polymerization processes. The molecule consists of two N-butyl-2-methylpropionamide groups linked by an azo group (N=N), which decomposes upon heating to generate free radicals. This property makes it particularly useful in the manufacturing of plastics and rubber, where it helps initiate the polymerization of monomers into polymers. Its ability to break down into radicals at predictable temperatures allows for controlled reactions, crucial in creating polymers with desired properties such as strength, flexibility, and durability.
CAS Number | 195520-32-2 |
Synonyms | 2,2′-AZOBIS(N-BUTYL-2-METHYLPROPIONAMIDE) |
Molecular Formula | C16H32N4O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | N-butyl-2-[[1-(butylamino)-2-methyl-1-oxopropan-2-yl]diazenyl]-2-methylpropanamide |
InChI | InChI=1S/C16H32N4O2/c1-7-9-11-17-13(21)15(3,4)19-20-16(5,6)14(22)18-12-10-8-2/h7-12H2,1-6H3,(H,17,21)(H,18,22) |
InChIKey | SFLRURCEBYIKSS-UHFFFAOYSA-N |
SMILES | CCCCNC(=O)C(C)(C)N=NC(C)(C)C(=O)NCCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |