For research use only. Not for therapeutic Use.
2,2′-[1,3-Phenylenebis(oxymethylene)]dioxirane (Cat No.: M069901) is a strained, three-membered ring compound incorporating two dioxirane units linked through a 1,3-phenylene core via oxymethylene bridges. This highly reactive molecule is studied primarily for its oxidative capabilities, particularly in epoxidation and oxygen-transfer reactions. Due to its ring strain and electrophilic oxygen atoms, it is of interest in synthetic organic chemistry for selective oxidation processes. Its potential as a mild, metal-free oxidant makes it valuable in green chemistry and mechanistic studies of reactive oxygen species.
CAS Number | 101-90-6 |
Molecular Formula | C12H14O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[[3-(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
InChI | InChI=1S/C12H14O4/c1-2-9(13-5-11-7-15-11)4-10(3-1)14-6-12-8-16-12/h1-4,11-12H,5-8H2 |
InChIKey | WPYCRFCQABTEKC-UHFFFAOYSA-N |
SMILES | C1C(O1)COC2=CC(=CC=C2)OCC3CO3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |