For research use only. Not for therapeutic Use.
20S Proteasome-IN-1(Cat No.:I032882)is a potent and selective inhibitor of the 20S proteasome, a key enzyme complex responsible for degrading unneeded or damaged proteins in cells. By inhibiting the proteasome, 20S Proteasome-IN-1 disrupts protein homeostasis, leading to the accumulation of misfolded or damaged proteins. This can induce cellular stress, triggering apoptosis, particularly in cancer cells. The compound is studied for its potential therapeutic applications in oncology, where proteasome inhibition is used to target rapidly dividing cancer cells. It also holds promise in neurodegenerative diseases, where protein aggregation is a key factor.
| CAS Number | 858557-69-4 |
| Synonyms | (2,6-dimethoxyphenyl)-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone |
| Molecular Formula | C23H25N3O4 |
| Purity | ≥95% |
| IUPAC Name | (2,6-dimethoxyphenyl)-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl]methanone |
| InChI | InChI=1S/C23H25N3O4/c1-15-7-9-16(10-8-15)21-24-22(30-25-21)17-11-13-26(14-12-17)23(27)20-18(28-2)5-4-6-19(20)29-3/h4-10,17H,11-14H2,1-3H3 |
| InChIKey | MPMGADZKWJDRRX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NOC(=N2)C3CCN(CC3)C(=O)C4=C(C=CC=C4OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |