For research use only. Not for therapeutic Use.
20-Hydroxyicosanoic acid (Cat.No:L003715) is a crucial fatty acid derivative with significant biological implications. This compound, formed by the hydroxylation of arachidonic acid, plays a key role in various physiological processes, including inflammation and blood pressure regulation. It serves as a precursor to potent lipid mediators known as hydroxyeicosanoids.
| CAS Number | 62643-46-3 |
| Molecular Formula | C20H40O3 |
| Purity | ≥95% |
| IUPAC Name | 20-hydroxyicosanoic acid |
| InChI | InChI=1S/C20H40O3/c21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(22)23/h21H,1-19H2,(H,22,23) |
| InChIKey | JLDIWYKSFMPIDW-UHFFFAOYSA-N |
| SMILES | C(CCCCCCCCCC(=O)O)CCCCCCCCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |