For research use only. Not for therapeutic Use.
20-HC-Me-Pyrrolidine（Cat No.:I044021）is a chemical compound with a pyrrolidine ring structure, often used in chemical synthesis and research applications. The “20-HC” part of the name typically refers to a specific functional group or modification, while “Me” indicates the presence of a methyl group. This compound could be used in studies of molecular interactions, drug development, or as a building block in the synthesis of more complex molecules. Its unique structure may make it valuable in designing compounds with specific pharmacological or chemical properties, particularly in the fields of medicinal and synthetic chemistry.
| Molecular Formula | C28H47NO2 |
| Purity | ≥95% |
| IUPAC Name | 2-[(3S,8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-(2-pyrrolidin-1-ylethoxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]propan-2-ol |
| InChI | InChI=1S/C28H47NO2/c1-26(2,30)25-10-9-23-22-8-7-20-19-21(31-18-17-29-15-5-6-16-29)11-13-27(20,3)24(22)12-14-28(23,25)4/h7,21-25,30H,5-6,8-19H2,1-4H3/t21-,22-,23-,24-,25+,27-,28-/m0/s1 |
| InChIKey | DKATTWHEAIAIAT-XMLICAENSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(C)(C)O)CC=C4[C@@]3(CC[C@@H](C4)OCCN5CCCC5)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
