20α-Dihydrodydrogesterone (Cat No.:C000884) is a synthetic derivative of progesterone, a naturally occurring female hormone. It is a progestin, a class of hormones that play a key role in the female reproductive system and menstrual cycle. 20α-Dihydrodydrogesterone is used in pharmaceuticals as an active ingredient in medications such as oral contraceptives and hormone replacement therapy. Its progestogenic activity helps regulate the menstrual cycle and support pregnancy. This compound is designed to mimic the effects of natural progesterone, providing therapeutic benefits for women’s health conditions, including menstrual disorders, infertility, and menopausal symptoms.
| Catalog Number | C000884 |
| CAS Number | 4243-74-7 |
| Synonyms | (9β,10α,20S)-20-Hydroxypregna-4,6-dien-3-one; 20α-Hydroxy-9β,10α-pregna-4,6-dien-3-one; 20α-Hydroxydydrogesterone; |
| Molecular Formula | C₂₁H₃₀O₂ |
| Purity | ≥95% |
| Appearance | Pale Yellow to Yellow Solid |
| Storage | 4°C |
| IUPAC Name | (8S,9R,10S,13S,14S,17S)-17-[(1S)-1-hydroxyethyl]-10,13-dimethyl-1,2,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| InChI | InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h4-5,12-13,16-19,22H,6-11H2,1-3H3/t13-,16-,17+,18-,19+,20+,21+/m0/s1 |
| InChIKey | IQPNZLYVKOVQGH-LBDMABOLSA-N |
| SMILES | CC(C1CCC2C1(CCC3C2C=CC4=CC(=O)CCC34C)C)O |
| Reference | Olbrich, M., et al.: Xenobiotica, 46, 868-874 (2016) |
