For research use only. Not for therapeutic Use.
2-Thiouridine (s Modified nucleobases, including 2-thiouridine, are used to study nucleic acid structure and function as well as to engineer novel RNA-based biomolecules.
| CAS Number | 20235-78-3 |
| Synonyms | 1-β-D-Ribofuranosyl-2-thiouracil; |
| Molecular Formula | C9H12N2O5S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-sulfanylidenepyrimidin-4-one |
| InChI | InChI=1S/C9H12N2O5S/c12-3-4-6(14)7(15)8(16-4)11-2-1-5(13)10-9(11)17/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,17)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | GJTBSTBJLVYKAU-XVFCMESISA-N |
| SMILES | C1=CN(C(=S)NC1=O)C2C(C(C(O2)CO)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |