2-Tetradecanol (Cat No.:C001131), also known as myristyl alcohol, is a long-chain fatty alcohol with 14 carbon atoms. It is naturally found in plants and animals and serves as an emollient in skin care products, providing moisturizing and softening effects. This compound is utilized in detergents, surfactants, lubricants, and as an intermediate in chemical synthesis.
| Catalog Number | C001131 |
| CAS Number | 4706-81-4 |
| Synonyms | (±)-2-Tetradecanol; 1-Methyltridecyl Alcohol; NSC 87599 |
| Molecular Formula | C₁₄H₃₀O |
| Purity | 95% |
| Solubility | Chloroform (Sparingly), Methanol (Slightly, Heated, Sonicated) |
| Storage | 4°C, Inert atmosphere |
| IUPAC Name | tetradecan-2-ol |
| InChI | InChI=1S/C14H30O/c1-3-4-5-6-7-8-9-10-11-12-13-14(2)15/h14-15H,3-13H2,1-2H3 |
| InChIKey | BRGJIIMZXMWMCC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCC(C)O |
| Reference | Pisanelli, A. M., et al.: AIP Conf. Proc., 1137, 133 (2009) |
