For research use only. Not for therapeutic Use.
2-(Pyrimidin-5-yl)benzaldehyde(Cat No.:L046091)is a heterocyclic aromatic compound featuring a benzaldehyde moiety linked to a pyrimidine ring at the 5-position. This unique structure makes it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. It is widely used in research involving the development of novel bioactive molecules, particularly in medicinal chemistry. The compound’s reactivity and versatility enable the exploration of diverse chemical reactions, making 2-(Pyrimidin-5-yl)benzaldehyde essential for advancing drug discovery and synthetic methodologies.
CAS Number | 640769-71-7 |
Molecular Formula | C11H8N2O |
Purity | ≥95% |
IUPAC Name | 2-pyrimidin-5-ylbenzaldehyde |
InChI | InChI=1S/C11H8N2O/c14-7-9-3-1-2-4-11(9)10-5-12-8-13-6-10/h1-8H |
InChIKey | JPSJBEALHNYNBL-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C=O)C2=CN=CN=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |