Home
>
Chemical Reagents>Organic Building Blocks> 2-Propenoic acid, 2-methyl-, 4-hydroxyphenyl ester
For research use only. Not for therapeutic Use.
2-Propenoic acid, 2-methyl-, 4-hydroxyphenyl ester (Cat.No:L003923) is a vital chemical compound with diverse applications. Its unique structure, combining acrylic acid and a 4-hydroxyphenyl ester, imparts specialized reactivity and properties. This compound serves as a valuable building block in the synthesis of specialized materials and pharmaceuticals.
| CAS Number | 31480-93-0 |
| Molecular Formula | C10H10O3 |
| Purity | ≥95% |
| IUPAC Name | (4-hydroxyphenyl) 2-methylprop-2-enoate |
| InChI | InChI=1S/C10H10O3/c1-7(2)10(12)13-9-5-3-8(11)4-6-9/h3-6,11H,1H2,2H3 |
| InChIKey | PJMXUSNWBKGQEZ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=CC=C(C=C1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |