For research use only. Not for therapeutic Use.
2-Phenylindole is an organic compound consisting of an indole ring substituted with a phenyl group at the 2-position. This compound is widely used in organic synthesis and medicinal chemistry due to its structural resemblance to bioactive molecules, including hormones and neurotransmitters. It serves as a key intermediate in the development of pharmaceutical agents and fluorescent dyes. Researchers explore its potential applications in drug discovery, particularly for anticancer, antimicrobial, and anti-inflammatory therapies, given the indole ring’s known biological activity.
CAS Number | 948-65-2 |
Molecular Formula | C14H11N |
Purity | ≥95% |
IUPAC Name | 2-phenyl-1H-indole |
InChI | InChI=1S/C14H11N/c1-2-6-11(7-3-1)14-10-12-8-4-5-9-13(12)15-14/h1-10,15H |
InChIKey | KLLLJCACIRKBDT-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3N2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |