For research use only. Not for therapeutic Use.
2-Phenylbenzylamine hydrochloride(Cat No.:M119798)is an aromatic amine salt composed of a biphenyl-linked benzylamine structure, typically supplied as a crystalline solid. The hydrochloride form enhances its stability and solubility in water, making it suitable for use in organic synthesis and pharmaceutical intermediate development. Its structural features support applications in medicinal chemistry, particularly in the synthesis of bioactive molecules targeting neurological or receptor-based pathways. The presence of both aromatic and amine functional groups allows for versatile reactivity, including reductive amination, coupling reactions, and derivatization in fine chemical manufacturing.
CAS Number | 1924-77-2 |
Molecular Formula | C13H13N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2-phenylphenyl)methanamine |
InChI | InChI=1S/C13H13N/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11/h1-9H,10,14H2 |
InChIKey | YHXKXVFQHWJYOD-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC=CC=C2CN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |