For research use only. Not for therapeutic Use.
2-Pentynoic Acid Ethyl Ester（Cat No.:R062762）, also known as ethyl 2-pentynoate, is an alkyne-functionalized carboxylic acid ester used as a versatile intermediate in organic synthesis. Featuring a terminal triple bond and an ethyl ester group, it enables various transformations such as nucleophilic additions, coupling reactions, and cyclizations. This compound is valuable in the development of pharmaceuticals, agrochemicals, and materials science applications. Its reactivity makes it suitable for building complex molecular frameworks. Supplied at high purity, it is ideal for research in synthetic, medicinal, and heterocyclic chemistry.
| CAS Number | 55314-57-3 |
| Synonyms | Ethyl 2-Pentynoate; NSC 190964 |
| Molecular Formula | C7H10O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl pent-2-ynoate |
| InChI | InChI=1S/C7H10O2/c1-3-5-6-7(8)9-4-2/h3-4H2,1-2H3 |
| InChIKey | XDPRPKSTFBPPHU-UHFFFAOYSA-N |
| SMILES | CCC#CC(=O)OCC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
