For research use only. Not for therapeutic Use.
2-Oxo-1-benzimidazolinebutyric acid (Cat No.: R010720) is a heterocyclic compound featuring a benzimidazoline ring with a ketone (oxo) group at position 2 and a butyric acid side chain. This structure combines aromatic and aliphatic features, making it a versatile intermediate in pharmaceutical and biochemical research. The benzimidazoline moiety is known for its bioactivity and potential interaction with enzymes or receptors, while the carboxylic acid allows for further derivatization. It is studied for potential roles in drug development, especially in CNS and metabolic pathways.
| CAS Number | 3273-68-5 |
| Synonyms | 2,3-Dihydro-2-oxo-1H-benzimidazole-1-butanoic Acid |
| Molecular Formula | C11H12N2O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-(2-oxo-3H-benzimidazol-1-yl)butanoic acid |
| InChI | InChI=1S/C11H12N2O3/c14-10(15)6-3-7-13-9-5-2-1-4-8(9)12-11(13)16/h1-2,4-5H,3,6-7H2,(H,12,16)(H,14,15) |
| InChIKey | PTNUQSFEJXMNOQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)N2CCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |