2-Octyl cyanoacrylate（Cat No.:M130471） is a monomeric adhesive that polymerizes rapidly in the presence of weak bases, such as water or blood, to form a strong and flexible polymer known as poly(2-octyl cyanoacrylate). This adhesive is commonly used in medical applications as a tissue adhesive or a wound closure agent due to its biocompatibility and ability to create a flexible and waterproof seal. It is particularly useful in closing minor cuts and surgical incisions where traditional sutures may be difficult to use. The adhesive nature of 2-octyl cyanoacrylate allows for quick and efficient wound closure, promoting faster healing and reducing the risk of infection.
| Catalog Number | M130471 |
| CAS Number | 133978-15-1 |
| Molecular Formula | C12H19NO2 |
| Purity | 95% |
| Storage | Desiccate at -20°C |
| IUPAC Name | octan-2-yl 2-cyanoprop-2-enoate |
| InChI | InChI=1S/C12H19NO2/c1-4-5-6-7-8-11(3)15-12(14)10(2)9-13/h11H,2,4-8H2,1,3H3 |
| InChIKey | CQVWXNBVRLKXPE-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)OC(=O)C(=C)C#N |
