For research use only. Not for therapeutic Use.
2-Nitro-1-phenylpropane(Cat No.:M076977) is an organic compound characterized by a nitro group (NO2) attached to the second carbon of a phenyl-substituted propane backbone. It is commonly used as a precursor in organic synthesis, particularly in the preparation of various pharmaceuticals, agrochemicals, and fine chemicals. This compound is synthesized through nitration reactions involving the addition of a nitro group to the alkyl chain of phenylpropane. Its versatile reactivity allows for the introduction of functional groups or structural modifications, enabling the creation of diverse organic molecules with potential applications in medicinal chemistry, materials science, and other fields.
| CAS Number | 17322-34-8 |
| Molecular Formula | C9H11NO2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | 2-nitropropylbenzene |
| InChI | InChI=1S/C9H11NO2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | OQBJLKIDAPUHSY-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC=CC=C1)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |