For research use only. Not for therapeutic Use.
2-Naphthaleneboronic acid（Cat No.:L048644）is an aromatic organoboron compound featuring a boronic acid group (-B(OH)₂) at the 2-position of a naphthalene ring system. It is widely used as a key intermediate in Suzuki–Miyaura cross-coupling reactions for constructing biaryl and heteroaryl compounds in pharmaceutical, agrochemical, and material science applications. The extended π-conjugated naphthalene structure offers enhanced rigidity and electronic delocalization, making it valuable for optoelectronic and polymer research. The boronic acid functionality enables reversible covalent interactions and further derivatization, supporting its role in chemical sensor development and molecular recognition studies.
| CAS Number | 32316-92-0 |
| Molecular Formula | C10H9BO2 |
| Purity | ≥95% |
| IUPAC Name | naphthalen-2-ylboronic acid |
| InChI | InChI=1S/C10H9BO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7,12-13H |
| InChIKey | KPTRDYONBVUWPD-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=CC=CC=C2C=C1)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
