2-Monoacetin, also known as glycerol monoacetate, is an ester formed from glycerol and acetic acid. It is a clear, viscous liquid used in the food and cosmetic industries as an emulsifier, humectant, and solvent. In biochemical research, 2-Monoacetin is utilized to study lipid metabolism and as a precursor in the synthesis of more complex glycerides and bioactive molecules.
| Catalog Number | R027703 |
| CAS Number | 100-78-7 |
| Synonyms | 1,3-Dihydroxypropan-2-yl Acetate; 2-Acetoxypropane-1,3-diol; Glycerine 2-Acetate; Glycerol 2-Acetate; Glycerol β-Monoacetate |
| Molecular Formula | C5H10O4 |
| Purity | 95% |
| Storage | -20°C |
| IUPAC Name | 1,3-dihydroxypropan-2-yl acetate |
| InChI | InChI=1S/C5H10O4/c1-4(8)9-5(2-6)3-7/h5-7H,2-3H2,1H3 |
| InChIKey | QPCIUXWQCCFLCI-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(CO)CO |
