For research use only. Not for therapeutic Use.
2-Methylthio-AMP (Cat No.:I044347) is a synthetic adenosine monophosphate analog characterized by a methylthio group at the 2-position of the adenine ring. It serves as a metabolite or precursor of 2-methylthio-ATP and is commonly used in research to study purinergic signaling, particularly involving P2Y receptors. 2-MeS-AMP is less active than its triphosphate form but plays a role in modulating cellular responses such as platelet aggregation, immune regulation, and inflammation. Its structural modifications make it useful for investigating nucleotide receptor selectivity, signaling mechanisms, and potential pharmacological targeting in purinergic pathways.
| CAS Number | 22140-20-1 |
| Synonyms | [(2R,3S,4R,5R)-5-(6-amino-2-methylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| Molecular Formula | C11H16N5O7PS |
| Purity | ≥95% |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-amino-2-methylsulfanylpurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| InChI | InChI=1S/C11H16N5O7PS/c1-25-11-14-8(12)5-9(15-11)16(3-13-5)10-7(18)6(17)4(23-10)2-22-24(19,20)21/h3-4,6-7,10,17-18H,2H2,1H3,(H2,12,14,15)(H2,19,20,21)/t4-,6-,7-,10-/m1/s1 |
| InChIKey | XVTFTCNRRAQHEQ-KQYNXXCUSA-N |
| SMILES | CSC1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)O)O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
