For research use only. Not for therapeutic Use.
2-(Methylthio)acetamide（Cat No.:R074516）is an organosulfur compound featuring a thioether group (-SCH₃) attached to an acetamide backbone. This compound serves as a valuable intermediate in the synthesis of heterocycles, pharmaceuticals, and agrochemicals. Its sulfur-containing structure makes it useful for studying nucleophilic substitution reactions and sulfur-mediated transformations. It is also explored in medicinal chemistry for its potential bioactivity and in biochemical studies involving sulfur metabolism. Supplied at high purity, 2-(Methylthio)acetamide is ideal for use in synthetic organic chemistry, drug discovery, and structure–activity relationship (SAR) investigations.
| CAS Number | 22551-24-2 |
| Molecular Formula | C3H7NOS |
| Purity | ≥95% |
| IUPAC Name | 2-methylsulfanylacetamide |
| InChI | InChI=1S/C3H7NOS/c1-6-2-3(4)5/h2H2,1H3,(H2,4,5) |
| InChIKey | OBENGAMZEGRSIC-UHFFFAOYSA-N |
| SMILES | CSCC(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
