2-Methylbutyl isobutyrate(Cat No.:M009899) is an organic ester compound formed by the reaction of 2-methylbutanol with isobutyric acid. Known for its fruity aroma, this chemical is commonly used as a flavoring agent and fragrance additive in the food and perfume industries. Its distinct scent resembles that of apples and other ripe fruits, making it a desirable ingredient in various consumer products to enhance sensory appeal. Additionally, its volatility and pleasant smell make it useful in the formulation of fragrances and cosmetics, where it contributes to the overall fragrance profile of the product.
Catalog Number | M009899 |
CAS Number | 2445-69-4 |
Synonyms | 2-Methylbutyl isobutyrate;Isobutyric acid, 2-methylbutyl ester;Propanoic acid, 2-methyl-, 2-methylbutyl ester;METHYL-2-BUTYL-ISO-BUTYRATE;2-Methylpropanoic acid 2-methylbutyl ester;2-Methylbutyl 2-methylpropionate;Isoamyl isobutyrate;2-methylbutyl 2- |
Molecular Formula | C9H18O2 |
Purity | 95% |
Storage | Store at RT |
IUPAC Name | 2-methylbutyl 2-methylpropanoate |
InChI | InChI=1S/C9H18O2/c1-5-8(4)6-11-9(10)7(2)3/h7-8H,5-6H2,1-4H3 |
InChIKey | DUAXUBMIVRZGCO-UHFFFAOYSA-N |
SMILES | CCC(C)COC(=O)C(C)C |