Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-Methyl[1,2,4]triazolo[1,5-a]pyridin-8-amine
For research use only. Not for therapeutic Use.
2-Methyl[1,2,4]triazolo[1,5-a]pyridin-8-amine(CAT: L030914) is a high-purity heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a triazolopyridine scaffold with a methyl substitution and an amine group at the 8-position, this compound is a versatile intermediate for synthesizing bioactive molecules, drug candidates, and advanced materials. Its unique structure makes it particularly valuable in medicinal chemistry for developing therapeutic agents and exploring structure-activity relationships. With excellent stability and reactivity, 2-Methyl[1,2,4]triazolo[1,5-a]pyridin-8-amine ensures precision and reliability, making it an essential tool for advanced research and innovative synthetic applications.
| CAS Number | 7169-93-9 |
| Molecular Formula | C7H8N4 |
| Purity | ≥95% |
| IUPAC Name | 2-methyl-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| InChI | InChI=1S/C7H8N4/c1-5-9-7-6(8)3-2-4-11(7)10-5/h2-4H,8H2,1H3 |
| InChIKey | JNANRNUHYLQPFB-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=CC=C(C2=N1)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |