For research use only. Not for therapeutic Use.
2-Methyl-5-nitroimidazole (Cat No.:R048509) is a chemical compound. It features a nitro group and a methyl group attached to an imidazole ring. This compound is significant in medicinal chemistry and pharmaceutical research due to its role as a building block for synthesizing various pharmaceuticals and bioactive molecules. Imidazole derivatives often exhibit biological activities, and the presence of a nitro group can enhance their reactivity and interactions with biological targets. 2-Methyl-5-nitroimidazole’s structural features make it valuable for creating novel compounds for drug discovery and research into new therapeutic agents.
CAS Number | 696-23-1 |
Synonyms | 2-Methyl-5-nitro-1H-imidazole; L 581490; Menidazole; RP 8532; USP Tinidazole Related Compound A: |
Molecular Formula | C4H5N3O2 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-methyl-5-nitro-1H-imidazole |
InChI | InChI=1S/C4H5N3O2/c1-3-5-2-4(6-3)7(8)9/h2H,1H3,(H,5,6) |
InChIKey | FFYTTYVSDVWNMY-UHFFFAOYSA-N |
SMILES | CC1=NC=C(N1)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |