For research use only. Not for therapeutic Use.
2-Methyl-5-nitrobenzotrifluoride(Cat No.:L019387)is an aromatic compound featuring a trifluoromethyl group, a methyl group at the ortho position, and a nitro group at the meta position on a benzene ring. This trifluoromethylated nitroarene is used as an intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. The electron-withdrawing trifluoromethyl and nitro groups enhance the compound’s reactivity in nucleophilic aromatic substitution reactions. Its chemical stability and lipophilicity make it useful for modifying molecular properties such as bioavailability and metabolic resistance. It is typically handled with care due to its nitroaromatic character.
| CAS Number | 89976-12-5 |
| Molecular Formula | C8H6F3NO2 |
| Purity | ≥95% |
| IUPAC Name | 1-methyl-4-nitro-2-(trifluoromethyl)benzene |
| InChI | InChI=1S/C8H6F3NO2/c1-5-2-3-6(12(13)14)4-7(5)8(9,10)11/h2-4H,1H3 |
| InChIKey | SVQCVQCIZWSPPX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |