For research use only. Not for therapeutic Use.
2-Methyl-5-nitro-1H-benzimidazole is a heterocyclic compound used in pharmaceutical research and organic synthesis. Its benzimidazole structure, featuring a methyl group at position 2 and a nitro group at position 5, gives it unique reactivity, making it valuable for developing bioactive molecules. This compound is often explored for its antimicrobial, antifungal, and antiparasitic properties, contributing to the development of therapeutic agents. Its versatility in chemical modifications supports advancements in medicinal chemistry and the creation of novel drugs and research compounds.
| CAS Number | 1792-40-1 |
| Molecular Formula | C8H7N3O2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 2-methyl-6-nitro-1H-benzimidazole |
| InChI | InChI=1S/C8H7N3O2/c1-5-9-7-3-2-6(11(12)13)4-8(7)10-5/h2-4H,1H3,(H,9,10) |
| InChIKey | RKRXTVLCZDPERO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |